C27H27N3O6S — CID 25230572
(4-methoxyphenyl)methyl 3-[[(2S,4S)-1-[(4-nitrophenyl)methyl]-4-sulfanylpyrrolidine-2-carbonyl]amino]benzoate (PubChem CID 25230572) has the molecular formula C27H27N3O6S and a molecular weight of 521.60 g/mol. Its IUPAC name is (4-methoxyphenyl)methyl 3-[[(2S,4S)-1-[(4-nitrophenyl)methyl]-4-sulfanylpyrrolidine-2-carbonyl]amino]benzoate.
| Compound Name | (4-methoxyphenyl)methyl 3-[[(2S,4S)-1-[(4-nitrophenyl)methyl]-4-sulfanylpyrrolidine-2-carbonyl]amino]benzoate |
|---|---|
| PubChem CID | 25230572 |
| Molecular Formula | C27H27N3O6S |
| Molecular Weight | 521.60 g/mol |
| Exact Mass | 521.16 |
| IUPAC Name | (4-methoxyphenyl)methyl 3-[[(2S,4S)-1-[(4-nitrophenyl)methyl]-4-sulfanylpyrrolidine-2-carbonyl]amino]benzoate |
| SMILES | COc1ccc(COC(=O)c2cccc(NC(=O)[C@@H]3C[C@H](S)CN3Cc3ccc([N+](=O)[O-])cc3)c2)cc1 |
| InChI | InChI=1S/C27H27N3O6S/c1-35-23-11-7-19(8-12-23)17-36-27(32)20-3-2-4-21(13-20)28-26(31)25-14-24(37)16-29(25)15-18-5-9-22(10-6-18)30(33)34/h2-13,24-25,37H,14-17H2,1H3,(H,28,31)/t24-,25-/m0/s1 |
| InChIKey | KVELVFQZYPIUKN-DQEYMECFSA-N |
| XLogP | 4.47 |
| TPSA | 111.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.60 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|