C23H25F4N3O — CID 25230599
3-(2-fluorophenyl)-2-pentyl-N-[[3-(trifluoromethyl)phenyl]methyl]-3,4-dihydropyrazole-5-carboxamide (PubChem CID 25230599) has the molecular formula C23H25F4N3O and a molecular weight of 435.47 g/mol. Its IUPAC name is 3-(2-fluorophenyl)-2-pentyl-N-[[3-(trifluoromethyl)phenyl]methyl]-3,4-dihydropyrazole-5-carboxamide.
| Compound Name | 3-(2-fluorophenyl)-2-pentyl-N-[[3-(trifluoromethyl)phenyl]methyl]-3,4-dihydropyrazole-5-carboxamide |
|---|---|
| PubChem CID | 25230599 |
| Molecular Formula | C23H25F4N3O |
| Molecular Weight | 435.47 g/mol |
| Exact Mass | 435.19 |
| IUPAC Name | 3-(2-fluorophenyl)-2-pentyl-N-[[3-(trifluoromethyl)phenyl]methyl]-3,4-dihydropyrazole-5-carboxamide |
| SMILES | CCCCCN1N=C(C(=O)NCc2cccc(C(F)(F)F)c2)CC1c1ccccc1F |
| InChI | InChI=1S/C23H25F4N3O/c1-2-3-6-12-30-21(18-10-4-5-11-19(18)24)14-20(29-30)22(31)28-15-16-8-7-9-17(13-16)23(25,26)27/h4-5,7-11,13,21H,2-3,6,12,14-15H2,1H3,(H,28,31) |
| InChIKey | WWTWDLKVFZQJGX-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 44.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.47 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|