C22H25F2N3O — CID 25230667
3-(2-fluorophenyl)-N-[(3-fluorophenyl)methyl]-2-pentyl-3,4-dihydropyrazole-5-carboxamide (PubChem CID 25230667) has the molecular formula C22H25F2N3O and a molecular weight of 385.46 g/mol. Its IUPAC name is 3-(2-fluorophenyl)-N-[(3-fluorophenyl)methyl]-2-pentyl-3,4-dihydropyrazole-5-carboxamide.
| Compound Name | 3-(2-fluorophenyl)-N-[(3-fluorophenyl)methyl]-2-pentyl-3,4-dihydropyrazole-5-carboxamide |
|---|---|
| PubChem CID | 25230667 |
| Molecular Formula | C22H25F2N3O |
| Molecular Weight | 385.46 g/mol |
| Exact Mass | 385.20 |
| IUPAC Name | 3-(2-fluorophenyl)-N-[(3-fluorophenyl)methyl]-2-pentyl-3,4-dihydropyrazole-5-carboxamide |
| SMILES | CCCCCN1N=C(C(=O)NCc2cccc(F)c2)CC1c1ccccc1F |
| InChI | InChI=1S/C22H25F2N3O/c1-2-3-6-12-27-21(18-10-4-5-11-19(18)24)14-20(26-27)22(28)25-15-16-8-7-9-17(23)13-16/h4-5,7-11,13,21H,2-3,6,12,14-15H2,1H3,(H,25,28) |
| InChIKey | YMUPBNOTFGNTIE-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 44.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.46 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|