C23H34FN3O — CID 25230602
N-cyclooctyl-3-(2-fluorophenyl)-2-pentyl-3,4-dihydropyrazole-5-carboxamide (PubChem CID 25230602) has the molecular formula C23H34FN3O and a molecular weight of 387.54 g/mol. Its IUPAC name is N-cyclooctyl-3-(2-fluorophenyl)-2-pentyl-3,4-dihydropyrazole-5-carboxamide.
| Compound Name | N-cyclooctyl-3-(2-fluorophenyl)-2-pentyl-3,4-dihydropyrazole-5-carboxamide |
|---|---|
| PubChem CID | 25230602 |
| Molecular Formula | C23H34FN3O |
| Molecular Weight | 387.54 g/mol |
| Exact Mass | 387.27 |
| IUPAC Name | N-cyclooctyl-3-(2-fluorophenyl)-2-pentyl-3,4-dihydropyrazole-5-carboxamide |
| SMILES | CCCCCN1N=C(C(=O)NC2CCCCCCC2)CC1c1ccccc1F |
| InChI | InChI=1S/C23H34FN3O/c1-2-3-11-16-27-22(19-14-9-10-15-20(19)24)17-21(26-27)23(28)25-18-12-7-5-4-6-8-13-18/h9-10,14-15,18,22H,2-8,11-13,16-17H2,1H3,(H,25,28) |
| InChIKey | ZRVVHRPUUCRBBS-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 44.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.54 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|