C25H35N3O — CID 25230443
N-(2-adamantyl)-2-pentyl-3-phenyl-3,4-dihydropyrazole-5-carboxamide (PubChem CID 25230443) has the molecular formula C25H35N3O and a molecular weight of 393.58 g/mol. Its IUPAC name is N-(2-adamantyl)-2-pentyl-3-phenyl-3,4-dihydropyrazole-5-carboxamide.
| Compound Name | N-(2-adamantyl)-2-pentyl-3-phenyl-3,4-dihydropyrazole-5-carboxamide |
|---|---|
| PubChem CID | 25230443 |
| Molecular Formula | C25H35N3O |
| Molecular Weight | 393.58 g/mol |
| Exact Mass | 393.28 |
| IUPAC Name | N-(2-adamantyl)-2-pentyl-3-phenyl-3,4-dihydropyrazole-5-carboxamide |
| SMILES | CCCCCN1N=C(C(=O)NC2C3CC4CC(C3)CC2C4)CC1c1ccccc1 |
| InChI | InChI=1S/C25H35N3O/c1-2-3-7-10-28-23(19-8-5-4-6-9-19)16-22(27-28)25(29)26-24-20-12-17-11-18(14-20)15-21(24)13-17/h4-6,8-9,17-18,20-21,23-24H,2-3,7,10-16H2,1H3,(H,26,29) |
| InChIKey | AAWYILVBJLFYNG-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 44.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.58 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|