C16H20N4 — CID 25231665
N'-[[3-[(pyridin-2-ylmethylamino)methyl]phenyl]methyl]ethanimidamide (PubChem CID 25231665) has the molecular formula C16H20N4 and a molecular weight of 268.36 g/mol. Its IUPAC name is N'-[[3-[(pyridin-2-ylmethylamino)methyl]phenyl]methyl]ethanimidamide.
| Compound Name | N'-[[3-[(pyridin-2-ylmethylamino)methyl]phenyl]methyl]ethanimidamide |
|---|---|
| PubChem CID | 25231665 |
| Molecular Formula | C16H20N4 |
| Molecular Weight | 268.36 g/mol |
| Exact Mass | 268.17 |
| IUPAC Name | N'-[[3-[(pyridin-2-ylmethylamino)methyl]phenyl]methyl]ethanimidamide |
| SMILES | C/C(N)=N\Cc1cccc(CNCc2ccccn2)c1 |
| InChI | InChI=1S/C16H20N4/c1-13(17)20-11-15-6-4-5-14(9-15)10-18-12-16-7-2-3-8-19-16/h2-9,18H,10-12H2,1H3,(H2,17,20) |
| InChIKey | GIJSTAOKLYBLNV-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 63.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.36 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|