C24H28ClN3 — CID 25231828
N'-[[3-[(dibenzylamino)methyl]phenyl]methyl]ethanimidamide;hydrochloride (PubChem CID 25231828) has the molecular formula C24H28ClN3 and a molecular weight of 393.96 g/mol. Its IUPAC name is N'-[[3-[(dibenzylamino)methyl]phenyl]methyl]ethanimidamide;hydrochloride.
| Compound Name | N'-[[3-[(dibenzylamino)methyl]phenyl]methyl]ethanimidamide;hydrochloride |
|---|---|
| PubChem CID | 25231828 |
| Molecular Formula | C24H28ClN3 |
| Molecular Weight | 393.96 g/mol |
| Exact Mass | 393.20 |
| IUPAC Name | N'-[[3-[(dibenzylamino)methyl]phenyl]methyl]ethanimidamide;hydrochloride |
| SMILES | C/C(N)=N\Cc1cccc(CN(Cc2ccccc2)Cc2ccccc2)c1.Cl |
| InChI | InChI=1S/C24H27N3.ClH/c1-20(25)26-16-23-13-8-14-24(15-23)19-27(17-21-9-4-2-5-10-21)18-22-11-6-3-7-12-22;/h2-15H,16-19H2,1H3,(H2,25,26);1H |
| InChIKey | NXSSBQTZYGKKMP-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 41.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.96 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|