C24H29F3N4O5S — CID 25232037
(1S,3S,5S)-2-[(2S)-2-amino-2-[8-(4-methylsulfonylphenyl)-8-azabicyclo[3.2.1]octan-3-yl]acetyl]-2-azabicyclo[3.1.0]hexane-3-carbonitrile;2,2,2-trifluoroacetic acid (PubChem CID 25232037) has the molecular formula C24H29F3N4O5S and a molecular weight of 542.58 g/mol. Its IUPAC name is (1S,3S,5S)-2-[(2S)-2-amino-2-[8-(4-methylsulfonylphenyl)-8-azabicyclo[3.2.1]octan-3-yl]acetyl]-2-azabicyclo[3.1.0]hexane-3-carbonitrile;2,2,2-trifluoroacetic acid.
| Compound Name | (1S,3S,5S)-2-[(2S)-2-amino-2-[8-(4-methylsulfonylphenyl)-8-azabicyclo[3.2.1]octan-3-yl]acetyl]-2-azabicyclo[3.1.0]hexane-3-carbonitrile;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 25232037 |
| Molecular Formula | C24H29F3N4O5S |
| Molecular Weight | 542.58 g/mol |
| Exact Mass | 542.18 |
| IUPAC Name | (1S,3S,5S)-2-[(2S)-2-amino-2-[8-(4-methylsulfonylphenyl)-8-azabicyclo[3.2.1]octan-3-yl]acetyl]-2-azabicyclo[3.1.0]hexane-3-carbonitrile;2,2,2-trifluoroacetic acid |
| SMILES | CS(=O)(=O)c1ccc(N2C3CCC2CC([C@H](N)C(=O)N2[C@H](C#N)C[C@@H]4C[C@@H]42)C3)cc1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C22H28N4O3S.C2HF3O2/c1-30(28,29)19-6-4-15(5-7-19)25-16-2-3-17(25)10-14(9-16)21(24)22(27)26-18(12-23)8-13-11-20(13)26;3-2(4,5)1(6)7/h4-7,13-14,16-18,20-21H,2-3,8-11,24H2,1H3;(H,6,7)/t13-,14?,16?,17?,18+,20+,21+;/m1./s1 |
| InChIKey | QUNZIQPVKNVLML-QGXDRFMISA-N |
| XLogP | 2.31 |
| TPSA | 144.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.58 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |