C24H27F3N4O5S — CID 68767723
[(1S,3S,5R)-2-[(2S)-2-amino-2-[8-(4-methylsulfonylphenyl)-8-azabicyclo[3.2.1]octan-3-yl]acetyl]-3-cyano-2-azabicyclo[3.1.0]hexan-1-yl] 2,2,2-trifluoroacetate (PubChem CID 68767723) has the molecular formula C24H27F3N4O5S and a molecular weight of 540.56 g/mol. Its IUPAC name is [(1S,3S,5R)-2-[(2S)-2-amino-2-[8-(4-methylsulfonylphenyl)-8-azabicyclo[3.2.1]octan-3-yl]acetyl]-3-cyano-2-azabicyclo[3.1.0]hexan-1-yl] 2,2,2-trifluoroacetate.
| Compound Name | [(1S,3S,5R)-2-[(2S)-2-amino-2-[8-(4-methylsulfonylphenyl)-8-azabicyclo[3.2.1]octan-3-yl]acetyl]-3-cyano-2-azabicyclo[3.1.0]hexan-1-yl] 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 68767723 |
| Molecular Formula | C24H27F3N4O5S |
| Molecular Weight | 540.56 g/mol |
| Exact Mass | 540.17 |
| IUPAC Name | [(1S,3S,5R)-2-[(2S)-2-amino-2-[8-(4-methylsulfonylphenyl)-8-azabicyclo[3.2.1]octan-3-yl]acetyl]-3-cyano-2-azabicyclo[3.1.0]hexan-1-yl] 2,2,2-trifluoroacetate |
| SMILES | CS(=O)(=O)c1ccc(N2C3CCC2CC([C@H](N)C(=O)N2[C@H](C#N)C[C@@H]4C[C@]42OC(=O)C(F)(F)F)C3)cc1 |
| InChI | InChI=1S/C24H27F3N4O5S/c1-37(34,35)19-6-4-15(5-7-19)30-16-2-3-17(30)9-13(8-16)20(29)21(32)31-18(12-28)10-14-11-23(14,31)36-22(33)24(25,26)27/h4-7,13-14,16-18,20H,2-3,8-11,29H2,1H3/t13?,14-,16?,17?,18+,20+,23+/m1/s1 |
| InChIKey | FSCRUMCPLVEYBB-LLMLALBFSA-N |
| XLogP | 2.11 |
| TPSA | 133.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.56 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |