C32H32F2N6O3S — CID 25234132
N-[3-[6-[4-(1,4-dimethyl-3-oxopiperazin-2-yl)anilino]-4-methyl-5-oxopyrazin-2-yl]-2,5-difluorophenyl]-4,5,6,7-tetrahydro-1-benzothiophene-2-carboxamide (PubChem CID 25234132) has the molecular formula C32H32F2N6O3S and a molecular weight of 618.71 g/mol. Its IUPAC name is N-[3-[6-[4-(1,4-dimethyl-3-oxopiperazin-2-yl)anilino]-4-methyl-5-oxopyrazin-2-yl]-2,5-difluorophenyl]-4,5,6,7-tetrahydro-1-benzothiophene-2-carboxamide.
| Compound Name | N-[3-[6-[4-(1,4-dimethyl-3-oxopiperazin-2-yl)anilino]-4-methyl-5-oxopyrazin-2-yl]-2,5-difluorophenyl]-4,5,6,7-tetrahydro-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 25234132 |
| Molecular Formula | C32H32F2N6O3S |
| Molecular Weight | 618.71 g/mol |
| Exact Mass | 618.22 |
| IUPAC Name | N-[3-[6-[4-(1,4-dimethyl-3-oxopiperazin-2-yl)anilino]-4-methyl-5-oxopyrazin-2-yl]-2,5-difluorophenyl]-4,5,6,7-tetrahydro-1-benzothiophene-2-carboxamide |
| SMILES | CN1CCN(C)C(c2ccc(Nc3nc(-c4cc(F)cc(NC(=O)c5cc6c(s5)CCCC6)c4F)cn(C)c3=O)cc2)C1=O |
| InChI | InChI=1S/C32H32F2N6O3S/c1-38-12-13-39(2)31(42)28(38)18-8-10-21(11-9-18)35-29-32(43)40(3)17-24(36-29)22-15-20(33)16-23(27(22)34)37-30(41)26-14-19-6-4-5-7-25(19)44-26/h8-11,14-17,28H,4-7,12-13H2,1-3H3,(H,35,36)(H,37,41) |
| InChIKey | SQKVSRQCXXJKNZ-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 99.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.71 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |