C10H9Br2N3O2S2 — CID 25234561
[(E)-(6,8-dibromo-1,1-dioxo-2,3-dihydrothiochromen-4-ylidene)amino]thiourea (PubChem CID 25234561) has the molecular formula C10H9Br2N3O2S2 and a molecular weight of 427.14 g/mol. Its IUPAC name is [(E)-(6,8-dibromo-1,1-dioxo-2,3-dihydrothiochromen-4-ylidene)amino]thiourea.
| Compound Name | [(E)-(6,8-dibromo-1,1-dioxo-2,3-dihydrothiochromen-4-ylidene)amino]thiourea |
|---|---|
| PubChem CID | 25234561 |
| Molecular Formula | C10H9Br2N3O2S2 |
| Molecular Weight | 427.14 g/mol |
| Exact Mass | 424.85 |
| IUPAC Name | [(E)-(6,8-dibromo-1,1-dioxo-2,3-dihydrothiochromen-4-ylidene)amino]thiourea |
| SMILES | NC(=S)N/N=C1\CCS(=O)(=O)c2c(Br)cc(Br)cc21 |
| InChI | InChI=1S/C10H9Br2N3O2S2/c11-5-3-6-8(14-15-10(13)18)1-2-19(16,17)9(6)7(12)4-5/h3-4H,1-2H2,(H3,13,15,18)/b14-8+ |
| InChIKey | NJRMUCOMIAAJIT-RIYZIHGNSA-N |
| XLogP | 1.93 |
| TPSA | 84.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.14 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|