C16H12N10O2 — CID 25234825
8-cyclopropyl-3-[1-(tetrazol-2-yl)but-3-yn-2-yl]triazino[4,5-g][1,2,3]benzotriazine-4,9-dione (PubChem CID 25234825) has the molecular formula C16H12N10O2 and a molecular weight of 376.34 g/mol. Its IUPAC name is 8-cyclopropyl-3-[1-(tetrazol-2-yl)but-3-yn-2-yl]triazino[4,5-g][1,2,3]benzotriazine-4,9-dione.
| Compound Name | 8-cyclopropyl-3-[1-(tetrazol-2-yl)but-3-yn-2-yl]triazino[4,5-g][1,2,3]benzotriazine-4,9-dione |
|---|---|
| PubChem CID | 25234825 |
| Molecular Formula | C16H12N10O2 |
| Molecular Weight | 376.34 g/mol |
| Exact Mass | 376.11 |
| IUPAC Name | 8-cyclopropyl-3-[1-(tetrazol-2-yl)but-3-yn-2-yl]triazino[4,5-g][1,2,3]benzotriazine-4,9-dione |
| SMILES | C#CC(Cn1ncnn1)n1nnc2cc3c(=O)n(C4CC4)nnc3cc2c1=O |
| InChI | InChI=1S/C16H12N10O2/c1-2-9(7-24-18-8-17-21-24)25-15(27)11-5-14-12(6-13(11)19-22-25)16(28)26(23-20-14)10-3-4-10/h1,5-6,8-10H,3-4,7H2 |
| InChIKey | CIZRQJONMMGVPD-UHFFFAOYSA-N |
| XLogP | -0.91 |
| TPSA | 139.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.34 |
| LogP ≤ 5 | -0.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|