C19H22N2O4S — CID 25237449
N-[(Z)-1-(1,3-benzodioxol-5-yl)ethylideneamino]-4-tert-butylbenzenesulfonamide (PubChem CID 25237449) has the molecular formula C19H22N2O4S and a molecular weight of 374.46 g/mol. Its IUPAC name is N-[(Z)-1-(1,3-benzodioxol-5-yl)ethylideneamino]-4-tert-butylbenzenesulfonamide.
| Compound Name | N-[(Z)-1-(1,3-benzodioxol-5-yl)ethylideneamino]-4-tert-butylbenzenesulfonamide |
|---|---|
| PubChem CID | 25237449 |
| Molecular Formula | C19H22N2O4S |
| Molecular Weight | 374.46 g/mol |
| Exact Mass | 374.13 |
| IUPAC Name | N-[(Z)-1-(1,3-benzodioxol-5-yl)ethylideneamino]-4-tert-butylbenzenesulfonamide |
| SMILES | C/C(=N/NS(=O)(=O)c1ccc(C(C)(C)C)cc1)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C19H22N2O4S/c1-13(14-5-10-17-18(11-14)25-12-24-17)20-21-26(22,23)16-8-6-15(7-9-16)19(2,3)4/h5-11,21H,12H2,1-4H3/b20-13- |
| InChIKey | MNALUETZEMXSRD-MOSHPQCFSA-N |
| XLogP | 3.42 |
| TPSA | 76.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.46 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|