C10H12ClN3O2 — CID 25239160
N-(2-chloro-5-methylphenyl)-3-hydrazinyl-3-oxopropanamide (PubChem CID 25239160) has the molecular formula C10H12ClN3O2 and a molecular weight of 241.68 g/mol. Its IUPAC name is N-(2-chloro-5-methylphenyl)-3-hydrazinyl-3-oxopropanamide.
| Compound Name | N-(2-chloro-5-methylphenyl)-3-hydrazinyl-3-oxopropanamide |
|---|---|
| PubChem CID | 25239160 |
| Molecular Formula | C10H12ClN3O2 |
| Molecular Weight | 241.68 g/mol |
| Exact Mass | 241.06 |
| IUPAC Name | N-(2-chloro-5-methylphenyl)-3-hydrazinyl-3-oxopropanamide |
| SMILES | Cc1ccc(Cl)c(NC(=O)CC(=O)NN)c1 |
| InChI | InChI=1S/C10H12ClN3O2/c1-6-2-3-7(11)8(4-6)13-9(15)5-10(16)14-12/h2-4H,5,12H2,1H3,(H,13,15)(H,14,16) |
| InChIKey | XQDCRAABBROYAT-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.68 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|