C18H15NO7 — CID 2524029
[2-(1,3-benzodioxol-5-ylamino)-2-oxoethyl] 2-(4-formylphenoxy)acetate (PubChem CID 2524029) has the molecular formula C18H15NO7 and a molecular weight of 357.32 g/mol. Its IUPAC name is [2-(1,3-benzodioxol-5-ylamino)-2-oxoethyl] 2-(4-formylphenoxy)acetate.
| Compound Name | [2-(1,3-benzodioxol-5-ylamino)-2-oxoethyl] 2-(4-formylphenoxy)acetate |
|---|---|
| PubChem CID | 2524029 |
| Molecular Formula | C18H15NO7 |
| Molecular Weight | 357.32 g/mol |
| Exact Mass | 357.08 |
| IUPAC Name | [2-(1,3-benzodioxol-5-ylamino)-2-oxoethyl] 2-(4-formylphenoxy)acetate |
| SMILES | O=Cc1ccc(OCC(=O)OCC(=O)Nc2ccc3c(c2)OCO3)cc1 |
| InChI | InChI=1S/C18H15NO7/c20-8-12-1-4-14(5-2-12)23-10-18(22)24-9-17(21)19-13-3-6-15-16(7-13)26-11-25-15/h1-8H,9-11H2,(H,19,21) |
| InChIKey | SOSYYCQTEZRGAY-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 100.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.32 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|