C21H21ClF2O4 — CID 25242184
[(E,2S)-1,5-bis(phenylmethoxy)pent-3-en-2-yl] 2-chloro-2,2-difluoroacetate (PubChem CID 25242184) has the molecular formula C21H21ClF2O4 and a molecular weight of 410.84 g/mol. Its IUPAC name is [(E,2S)-1,5-bis(phenylmethoxy)pent-3-en-2-yl] 2-chloro-2,2-difluoroacetate.
| Compound Name | [(E,2S)-1,5-bis(phenylmethoxy)pent-3-en-2-yl] 2-chloro-2,2-difluoroacetate |
|---|---|
| PubChem CID | 25242184 |
| Molecular Formula | C21H21ClF2O4 |
| Molecular Weight | 410.84 g/mol |
| Exact Mass | 410.11 |
| IUPAC Name | [(E,2S)-1,5-bis(phenylmethoxy)pent-3-en-2-yl] 2-chloro-2,2-difluoroacetate |
| SMILES | O=C(O[C@@H](/C=C/COCc1ccccc1)COCc1ccccc1)C(F)(F)Cl |
| InChI | InChI=1S/C21H21ClF2O4/c22-21(23,24)20(25)28-19(16-27-15-18-10-5-2-6-11-18)12-7-13-26-14-17-8-3-1-4-9-17/h1-12,19H,13-16H2/b12-7+/t19-/m0/s1 |
| InChIKey | DCGRKNIYHXEVIL-UBIUBJKMSA-N |
| XLogP | 4.72 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.84 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|