C17H13F9O7 — CID 91699510
[2-phenylmethoxy-3,4-bis[(2,2,2-trifluoroacetyl)oxy]butyl] 2,2,2-trifluoroacetate (PubChem CID 91699510) has the molecular formula C17H13F9O7 and a molecular weight of 500.27 g/mol. Its IUPAC name is [2-phenylmethoxy-3,4-bis[(2,2,2-trifluoroacetyl)oxy]butyl] 2,2,2-trifluoroacetate.
| Compound Name | [2-phenylmethoxy-3,4-bis[(2,2,2-trifluoroacetyl)oxy]butyl] 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 91699510 |
| Molecular Formula | C17H13F9O7 |
| Molecular Weight | 500.27 g/mol |
| Exact Mass | 500.05 |
| IUPAC Name | [2-phenylmethoxy-3,4-bis[(2,2,2-trifluoroacetyl)oxy]butyl] 2,2,2-trifluoroacetate |
| SMILES | O=C(OCC(OCc1ccccc1)C(COC(=O)C(F)(F)F)OC(=O)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C17H13F9O7/c18-15(19,20)12(27)31-7-10(30-6-9-4-2-1-3-5-9)11(33-14(29)17(24,25)26)8-32-13(28)16(21,22)23/h1-5,10-11H,6-8H2 |
| InChIKey | QVSPLHGYEGENNA-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.27 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|