C17H12F3N3OS — CID 25243756
4,7-dimethyl-10-[(2,3,4-trifluorophenyl)methyl]-3-thia-7,10,11-triazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),4,11-tetraen-9-one (PubChem CID 25243756) has the molecular formula C17H12F3N3OS and a molecular weight of 363.36 g/mol. Its IUPAC name is 4,7-dimethyl-10-[(2,3,4-trifluorophenyl)methyl]-3-thia-7,10,11-triazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),4,11-tetraen-9-one.
| Compound Name | 4,7-dimethyl-10-[(2,3,4-trifluorophenyl)methyl]-3-thia-7,10,11-triazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),4,11-tetraen-9-one |
|---|---|
| PubChem CID | 25243756 |
| Molecular Formula | C17H12F3N3OS |
| Molecular Weight | 363.36 g/mol |
| Exact Mass | 363.07 |
| IUPAC Name | 4,7-dimethyl-10-[(2,3,4-trifluorophenyl)methyl]-3-thia-7,10,11-triazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),4,11-tetraen-9-one |
| SMILES | Cc1cc2c(s1)c1cnn(Cc3ccc(F)c(F)c3F)c(=O)c1n2C |
| InChI | InChI=1S/C17H12F3N3OS/c1-8-5-12-16(25-8)10-6-21-23(17(24)15(10)22(12)2)7-9-3-4-11(18)14(20)13(9)19/h3-6H,7H2,1-2H3 |
| InChIKey | NOZQDFSANILJNV-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 39.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.36 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|