C14H13F3N6O2S — CID 2524473
2-[[2-(4,6-diaminopyrimidin-2-yl)sulfanylacetyl]amino]-N-(2,3,4-trifluorophenyl)acetamide (PubChem CID 2524473) has the molecular formula C14H13F3N6O2S and a molecular weight of 386.36 g/mol. Its IUPAC name is 2-[[2-(4,6-diaminopyrimidin-2-yl)sulfanylacetyl]amino]-N-(2,3,4-trifluorophenyl)acetamide.
| Compound Name | 2-[[2-(4,6-diaminopyrimidin-2-yl)sulfanylacetyl]amino]-N-(2,3,4-trifluorophenyl)acetamide |
|---|---|
| PubChem CID | 2524473 |
| Molecular Formula | C14H13F3N6O2S |
| Molecular Weight | 386.36 g/mol |
| Exact Mass | 386.08 |
| IUPAC Name | 2-[[2-(4,6-diaminopyrimidin-2-yl)sulfanylacetyl]amino]-N-(2,3,4-trifluorophenyl)acetamide |
| SMILES | Nc1cc(N)nc(SCC(=O)NCC(=O)Nc2ccc(F)c(F)c2F)n1 |
| InChI | InChI=1S/C14H13F3N6O2S/c15-6-1-2-7(13(17)12(6)16)21-10(24)4-20-11(25)5-26-14-22-8(18)3-9(19)23-14/h1-3H,4-5H2,(H,20,25)(H,21,24)(H4,18,19,22,23) |
| InChIKey | WMCZXSSWNOLONU-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 136.02 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.36 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|