C12H13N5OS — CID 788521
2-(4,6-diaminopyrimidin-2-yl)sulfanyl-N-phenylacetamide (PubChem CID 788521) has the molecular formula C12H13N5OS and a molecular weight of 275.34 g/mol. Its IUPAC name is 2-(4,6-diaminopyrimidin-2-yl)sulfanyl-N-phenylacetamide.
| Compound Name | 2-(4,6-diaminopyrimidin-2-yl)sulfanyl-N-phenylacetamide |
|---|---|
| PubChem CID | 788521 |
| Molecular Formula | C12H13N5OS |
| Molecular Weight | 275.34 g/mol |
| Exact Mass | 275.08 |
| IUPAC Name | 2-(4,6-diaminopyrimidin-2-yl)sulfanyl-N-phenylacetamide |
| SMILES | Nc1cc(N)nc(SCC(=O)Nc2ccccc2)n1 |
| InChI | InChI=1S/C12H13N5OS/c13-9-6-10(14)17-12(16-9)19-7-11(18)15-8-4-2-1-3-5-8/h1-6H,7H2,(H,15,18)(H4,13,14,16,17) |
| InChIKey | IRGSJMYDZBSVTR-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 106.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.34 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |