C29H41N3O2 — CID 25246851
4-(4-benzhydrylpiperazin-1-yl)-N-(2-ethylhexyl)-4-oxobutanamide (PubChem CID 25246851) has the molecular formula C29H41N3O2 and a molecular weight of 463.67 g/mol. Its IUPAC name is 4-(4-benzhydrylpiperazin-1-yl)-N-(2-ethylhexyl)-4-oxobutanamide.
| Compound Name | 4-(4-benzhydrylpiperazin-1-yl)-N-(2-ethylhexyl)-4-oxobutanamide |
|---|---|
| PubChem CID | 25246851 |
| Molecular Formula | C29H41N3O2 |
| Molecular Weight | 463.67 g/mol |
| Exact Mass | 463.32 |
| IUPAC Name | 4-(4-benzhydrylpiperazin-1-yl)-N-(2-ethylhexyl)-4-oxobutanamide |
| SMILES | CCCCC(CC)CNC(=O)CCC(=O)N1CCN(C(c2ccccc2)c2ccccc2)CC1 |
| InChI | InChI=1S/C29H41N3O2/c1-3-5-12-24(4-2)23-30-27(33)17-18-28(34)31-19-21-32(22-20-31)29(25-13-8-6-9-14-25)26-15-10-7-11-16-26/h6-11,13-16,24,29H,3-5,12,17-23H2,1-2H3,(H,30,33) |
| InChIKey | KWYRADUOTCNGHO-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.67 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |