C28H40N2O2 — CID 132993174
1-(4-benzhydrylpiperazin-1-yl)-4-methoxydecan-1-one (PubChem CID 132993174) has the molecular formula C28H40N2O2 and a molecular weight of 436.64 g/mol. Its IUPAC name is 1-(4-benzhydrylpiperazin-1-yl)-4-methoxydecan-1-one.
| Compound Name | 1-(4-benzhydrylpiperazin-1-yl)-4-methoxydecan-1-one |
|---|---|
| PubChem CID | 132993174 |
| Molecular Formula | C28H40N2O2 |
| Molecular Weight | 436.64 g/mol |
| Exact Mass | 436.31 |
| IUPAC Name | 1-(4-benzhydrylpiperazin-1-yl)-4-methoxydecan-1-one |
| SMILES | CCCCCCC(CCC(=O)N1CCN(C(c2ccccc2)c2ccccc2)CC1)OC |
| InChI | InChI=1S/C28H40N2O2/c1-3-4-5-12-17-26(32-2)18-19-27(31)29-20-22-30(23-21-29)28(24-13-8-6-9-14-24)25-15-10-7-11-16-25/h6-11,13-16,26,28H,3-5,12,17-23H2,1-2H3 |
| InChIKey | DCVUIMHUZRVJGD-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.64 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|