C18H32N2O2 — CID 25246872
N-[2-(cyclohexen-1-yl)ethyl]-N',N'-diethyl-3-methylpentanediamide (PubChem CID 25246872) has the molecular formula C18H32N2O2 and a molecular weight of 308.47 g/mol. Its IUPAC name is N-[2-(cyclohexen-1-yl)ethyl]-N',N'-diethyl-3-methylpentanediamide.
| Compound Name | N-[2-(cyclohexen-1-yl)ethyl]-N',N'-diethyl-3-methylpentanediamide |
|---|---|
| PubChem CID | 25246872 |
| Molecular Formula | C18H32N2O2 |
| Molecular Weight | 308.47 g/mol |
| Exact Mass | 308.25 |
| IUPAC Name | N-[2-(cyclohexen-1-yl)ethyl]-N',N'-diethyl-3-methylpentanediamide |
| SMILES | CCN(CC)C(=O)CC(C)CC(=O)NCCC1=CCCCC1 |
| InChI | InChI=1S/C18H32N2O2/c1-4-20(5-2)18(22)14-15(3)13-17(21)19-12-11-16-9-7-6-8-10-16/h9,15H,4-8,10-14H2,1-3H3,(H,19,21) |
| InChIKey | DBTOWXACFLRCAY-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.47 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|