C13H13N3O4 — CID 25248036
5-[(2-hydroxy-5-methylphenyl)carbamoyl]-1-methylpyrazole-4-carboxylic acid (PubChem CID 25248036) has the molecular formula C13H13N3O4 and a molecular weight of 275.26 g/mol. Its IUPAC name is 5-[(2-hydroxy-5-methylphenyl)carbamoyl]-1-methylpyrazole-4-carboxylic acid.
| Compound Name | 5-[(2-hydroxy-5-methylphenyl)carbamoyl]-1-methylpyrazole-4-carboxylic acid |
|---|---|
| PubChem CID | 25248036 |
| Molecular Formula | C13H13N3O4 |
| Molecular Weight | 275.26 g/mol |
| Exact Mass | 275.09 |
| IUPAC Name | 5-[(2-hydroxy-5-methylphenyl)carbamoyl]-1-methylpyrazole-4-carboxylic acid |
| SMILES | Cc1ccc(O)c(NC(=O)c2c(C(=O)O)cnn2C)c1 |
| InChI | InChI=1S/C13H13N3O4/c1-7-3-4-10(17)9(5-7)15-12(18)11-8(13(19)20)6-14-16(11)2/h3-6,17H,1-2H3,(H,15,18)(H,19,20) |
| InChIKey | UAVWGAZUWCEHRD-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 104.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.26 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|