C18H16N2O3 — CID 25250095
cyclopropyl-(6-phenyldiazenyl-2,3-dihydro-1,4-benzodioxin-7-yl)methanone (PubChem CID 25250095) has the molecular formula C18H16N2O3 and a molecular weight of 308.34 g/mol. Its IUPAC name is cyclopropyl-(6-phenyldiazenyl-2,3-dihydro-1,4-benzodioxin-7-yl)methanone.
| Compound Name | cyclopropyl-(6-phenyldiazenyl-2,3-dihydro-1,4-benzodioxin-7-yl)methanone |
|---|---|
| PubChem CID | 25250095 |
| Molecular Formula | C18H16N2O3 |
| Molecular Weight | 308.34 g/mol |
| Exact Mass | 308.12 |
| IUPAC Name | cyclopropyl-(6-phenyldiazenyl-2,3-dihydro-1,4-benzodioxin-7-yl)methanone |
| SMILES | O=C(c1cc2c(cc1/N=N/c1ccccc1)OCCO2)C1CC1 |
| InChI | InChI=1S/C18H16N2O3/c21-18(12-6-7-12)14-10-16-17(23-9-8-22-16)11-15(14)20-19-13-4-2-1-3-5-13/h1-5,10-12H,6-9H2/b20-19+ |
| InChIKey | CTDFILZBURZQEF-FMQUCBEESA-N |
| XLogP | 4.47 |
| TPSA | 60.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.34 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|