C23H25FN6O4 — CID 25254924
6-amino-7-fluoro-N-hydroxy-4-oxo-8-[2-(pyridin-2-ylamino)ethylamino]spiro[10-oxa-1-azatricyclo[7.4.1.05,14]tetradeca-2,5,7,9(14)-tetraene-13,1'-cyclobutane]-3-carboxamide (PubChem CID 25254924) has the molecular formula C23H25FN6O4 and a molecular weight of 468.49 g/mol. Its IUPAC name is 6-amino-7-fluoro-N-hydroxy-4-oxo-8-[2-(pyridin-2-ylamino)ethylamino]spiro[10-oxa-1-azatricyclo[7.4.1.05,14]tetradeca-2,5,7,9(14)-tetraene-13,1'-cyclobutane]-3-carboxamide.
| Compound Name | 6-amino-7-fluoro-N-hydroxy-4-oxo-8-[2-(pyridin-2-ylamino)ethylamino]spiro[10-oxa-1-azatricyclo[7.4.1.05,14]tetradeca-2,5,7,9(14)-tetraene-13,1'-cyclobutane]-3-carboxamide |
|---|---|
| PubChem CID | 25254924 |
| Molecular Formula | C23H25FN6O4 |
| Molecular Weight | 468.49 g/mol |
| Exact Mass | 468.19 |
| IUPAC Name | 6-amino-7-fluoro-N-hydroxy-4-oxo-8-[2-(pyridin-2-ylamino)ethylamino]spiro[10-oxa-1-azatricyclo[7.4.1.05,14]tetradeca-2,5,7,9(14)-tetraene-13,1'-cyclobutane]-3-carboxamide |
| SMILES | Nc1c(F)c(NCCNc2ccccn2)c2c3c1c(=O)c(C(=O)NO)cn3C1(CCC1)CCO2 |
| InChI | InChI=1S/C23H25FN6O4/c24-16-17(25)15-19-21(18(16)28-10-9-27-14-4-1-2-8-26-14)34-11-7-23(5-3-6-23)30(19)12-13(20(15)31)22(32)29-33/h1-2,4,8,12,28,33H,3,5-7,9-11,25H2,(H,26,27)(H,29,32) |
| InChIKey | OMULJEFQBTTYKU-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 143.53 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.49 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|