C24H17N3O4 — CID 25255543
(19S)-19-ethyl-19-hydroxy-14,18-dioxo-7-prop-2-ynyl-17-oxa-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2,4(9),5,7,10,15(20)-heptaene-8-carbonitrile (PubChem CID 25255543) has the molecular formula C24H17N3O4 and a molecular weight of 411.42 g/mol. Its IUPAC name is (19S)-19-ethyl-19-hydroxy-14,18-dioxo-7-prop-2-ynyl-17-oxa-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2,4(9),5,7,10,15(20)-heptaene-8-carbonitrile.
| Compound Name | (19S)-19-ethyl-19-hydroxy-14,18-dioxo-7-prop-2-ynyl-17-oxa-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2,4(9),5,7,10,15(20)-heptaene-8-carbonitrile |
|---|---|
| PubChem CID | 25255543 |
| Molecular Formula | C24H17N3O4 |
| Molecular Weight | 411.42 g/mol |
| Exact Mass | 411.12 |
| IUPAC Name | (19S)-19-ethyl-19-hydroxy-14,18-dioxo-7-prop-2-ynyl-17-oxa-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2,4(9),5,7,10,15(20)-heptaene-8-carbonitrile |
| SMILES | C#CCc1ccc2nc3c(cc2c1C#N)Cn1c-3cc2c(c1=O)COC(=O)[C@]2(O)CC |
| InChI | InChI=1S/C24H17N3O4/c1-3-5-13-6-7-19-15(16(13)10-25)8-14-11-27-20(21(14)26-19)9-18-17(22(27)28)12-31-23(29)24(18,30)4-2/h1,6-9,30H,4-5,11-12H2,2H3/t24-/m0/s1 |
| InChIKey | KZWTWVDBPDFKJS-DEOSSOPVSA-N |
| XLogP | 2.13 |
| TPSA | 105.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.42 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|