C19H17Cl2N5O — CID 25255840
N-[1-[(3,4-dichlorophenyl)methyl]pyrazol-4-yl]-5,6,7,8-tetrahydro-1,6-naphthyridine-2-carboxamide (PubChem CID 25255840) has the molecular formula C19H17Cl2N5O and a molecular weight of 402.29 g/mol. Its IUPAC name is N-[1-[(3,4-dichlorophenyl)methyl]pyrazol-4-yl]-5,6,7,8-tetrahydro-1,6-naphthyridine-2-carboxamide.
| Compound Name | N-[1-[(3,4-dichlorophenyl)methyl]pyrazol-4-yl]-5,6,7,8-tetrahydro-1,6-naphthyridine-2-carboxamide |
|---|---|
| PubChem CID | 25255840 |
| Molecular Formula | C19H17Cl2N5O |
| Molecular Weight | 402.29 g/mol |
| Exact Mass | 401.08 |
| IUPAC Name | N-[1-[(3,4-dichlorophenyl)methyl]pyrazol-4-yl]-5,6,7,8-tetrahydro-1,6-naphthyridine-2-carboxamide |
| SMILES | O=C(Nc1cnn(Cc2ccc(Cl)c(Cl)c2)c1)c1ccc2c(n1)CCNC2 |
| InChI | InChI=1S/C19H17Cl2N5O/c20-15-3-1-12(7-16(15)21)10-26-11-14(9-23-26)24-19(27)18-4-2-13-8-22-6-5-17(13)25-18/h1-4,7,9,11,22H,5-6,8,10H2,(H,24,27) |
| InChIKey | RNGMQEFGHFIQCD-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 71.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.29 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |