C18H15NO3S — CID 25258605
(3,4-dimethoxyphenyl)-(2-phenyl-1,3-thiazol-4-yl)methanone (PubChem CID 25258605) has the molecular formula C18H15NO3S and a molecular weight of 325.39 g/mol. Its IUPAC name is (3,4-dimethoxyphenyl)-(2-phenyl-1,3-thiazol-4-yl)methanone.
| Compound Name | (3,4-dimethoxyphenyl)-(2-phenyl-1,3-thiazol-4-yl)methanone |
|---|---|
| PubChem CID | 25258605 |
| Molecular Formula | C18H15NO3S |
| Molecular Weight | 325.39 g/mol |
| Exact Mass | 325.08 |
| IUPAC Name | (3,4-dimethoxyphenyl)-(2-phenyl-1,3-thiazol-4-yl)methanone |
| SMILES | COc1ccc(C(=O)c2csc(-c3ccccc3)n2)cc1OC |
| InChI | InChI=1S/C18H15NO3S/c1-21-15-9-8-13(10-16(15)22-2)17(20)14-11-23-18(19-14)12-6-4-3-5-7-12/h3-11H,1-2H3 |
| InChIKey | GOWYUOGYQVBRKY-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 48.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.39 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |