C21H18N2O4S — CID 10430727
6-[2-(3,4-dimethoxybenzoyl)-1,3-thiazol-4-yl]-3,4-dihydro-1H-quinolin-2-one (PubChem CID 10430727) has the molecular formula C21H18N2O4S and a molecular weight of 394.45 g/mol. Its IUPAC name is 6-[2-(3,4-dimethoxybenzoyl)-1,3-thiazol-4-yl]-3,4-dihydro-1H-quinolin-2-one.
| Compound Name | 6-[2-(3,4-dimethoxybenzoyl)-1,3-thiazol-4-yl]-3,4-dihydro-1H-quinolin-2-one |
|---|---|
| PubChem CID | 10430727 |
| Molecular Formula | C21H18N2O4S |
| Molecular Weight | 394.45 g/mol |
| Exact Mass | 394.10 |
| IUPAC Name | 6-[2-(3,4-dimethoxybenzoyl)-1,3-thiazol-4-yl]-3,4-dihydro-1H-quinolin-2-one |
| SMILES | COc1ccc(C(=O)c2nc(-c3ccc4c(c3)CCC(=O)N4)cs2)cc1OC |
| InChI | InChI=1S/C21H18N2O4S/c1-26-17-7-4-14(10-18(17)27-2)20(25)21-23-16(11-28-21)13-3-6-15-12(9-13)5-8-19(24)22-15/h3-4,6-7,9-11H,5,8H2,1-2H3,(H,22,24) |
| InChIKey | GXJUSZGBRXHIAG-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 77.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.45 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |