C19H27FN4O6 — CID 25259133
2-fluoro-N-[(2S)-1-[[(2S)-1-(4-hydroxybutylamino)-1-oxopropan-2-yl]amino]-3-methyl-1-oxobutan-2-yl]-5-nitrobenzamide (PubChem CID 25259133) has the molecular formula C19H27FN4O6 and a molecular weight of 426.45 g/mol. Its IUPAC name is 2-fluoro-N-[(2S)-1-[[(2S)-1-(4-hydroxybutylamino)-1-oxopropan-2-yl]amino]-3-methyl-1-oxobutan-2-yl]-5-nitrobenzamide.
| Compound Name | 2-fluoro-N-[(2S)-1-[[(2S)-1-(4-hydroxybutylamino)-1-oxopropan-2-yl]amino]-3-methyl-1-oxobutan-2-yl]-5-nitrobenzamide |
|---|---|
| PubChem CID | 25259133 |
| Molecular Formula | C19H27FN4O6 |
| Molecular Weight | 426.45 g/mol |
| Exact Mass | 426.19 |
| IUPAC Name | 2-fluoro-N-[(2S)-1-[[(2S)-1-(4-hydroxybutylamino)-1-oxopropan-2-yl]amino]-3-methyl-1-oxobutan-2-yl]-5-nitrobenzamide |
| SMILES | CC(C)[C@H](NC(=O)c1cc([N+](=O)[O-])ccc1F)C(=O)N[C@@H](C)C(=O)NCCCCO |
| InChI | InChI=1S/C19H27FN4O6/c1-11(2)16(19(28)22-12(3)17(26)21-8-4-5-9-25)23-18(27)14-10-13(24(29)30)6-7-15(14)20/h6-7,10-12,16,25H,4-5,8-9H2,1-3H3,(H,21,26)(H,22,28)(H,23,27)/t12-,16-/m0/s1 |
| InChIKey | CHDYYEPMGHFSDI-LRDDRELGSA-N |
| XLogP | 0.88 |
| TPSA | 150.67 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.45 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|