C21H22O7 — CID 25259366
(4E)-4-[1-(3-hydroxy-4-methoxyphenyl)ethylidene]-6,7,8-trimethoxy-1H-isochromen-3-one (PubChem CID 25259366) has the molecular formula C21H22O7 and a molecular weight of 386.40 g/mol. Its IUPAC name is (4E)-4-[1-(3-hydroxy-4-methoxyphenyl)ethylidene]-6,7,8-trimethoxy-1H-isochromen-3-one.
| Compound Name | (4E)-4-[1-(3-hydroxy-4-methoxyphenyl)ethylidene]-6,7,8-trimethoxy-1H-isochromen-3-one |
|---|---|
| PubChem CID | 25259366 |
| Molecular Formula | C21H22O7 |
| Molecular Weight | 386.40 g/mol |
| Exact Mass | 386.14 |
| IUPAC Name | (4E)-4-[1-(3-hydroxy-4-methoxyphenyl)ethylidene]-6,7,8-trimethoxy-1H-isochromen-3-one |
| SMILES | COc1ccc(/C(C)=C2/C(=O)OCc3c2cc(OC)c(OC)c3OC)cc1O |
| InChI | InChI=1S/C21H22O7/c1-11(12-6-7-16(24-2)15(22)8-12)18-13-9-17(25-3)20(27-5)19(26-4)14(13)10-28-21(18)23/h6-9,22H,10H2,1-5H3/b18-11+ |
| InChIKey | LCRYVJACXZIEIU-WOJGMQOQSA-N |
| XLogP | 3.41 |
| TPSA | 83.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.40 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|