C26H28O5 — CID 46226686
2-methoxy-5-[(Z)-1-phenyl-2-(3,4,5-trimethoxyphenyl)but-1-enyl]phenol (PubChem CID 46226686) has the molecular formula C26H28O5 and a molecular weight of 420.51 g/mol. Its IUPAC name is 2-methoxy-5-[(Z)-1-phenyl-2-(3,4,5-trimethoxyphenyl)but-1-enyl]phenol.
| Compound Name | 2-methoxy-5-[(Z)-1-phenyl-2-(3,4,5-trimethoxyphenyl)but-1-enyl]phenol |
|---|---|
| PubChem CID | 46226686 |
| Molecular Formula | C26H28O5 |
| Molecular Weight | 420.51 g/mol |
| Exact Mass | 420.19 |
| IUPAC Name | 2-methoxy-5-[(Z)-1-phenyl-2-(3,4,5-trimethoxyphenyl)but-1-enyl]phenol |
| SMILES | CC/C(=C(\c1ccccc1)c1ccc(OC)c(O)c1)c1cc(OC)c(OC)c(OC)c1 |
| InChI | InChI=1S/C26H28O5/c1-6-20(19-15-23(29-3)26(31-5)24(16-19)30-4)25(17-10-8-7-9-11-17)18-12-13-22(28-2)21(27)14-18/h7-16,27H,6H2,1-5H3/b25-20- |
| InChIKey | BFGQIESXNRVOAN-QQTULTPQSA-N |
| XLogP | 5.80 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.51 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|