C36H42Cl2F3N5O2 — CID 25261186
[(4S,5R)-2-(6-tert-butyl-4-ethoxy-3-pyridinyl)-4,5-bis(4-chlorophenyl)-4,5-dimethylimidazol-1-yl]-[4-(3,3,3-trifluoropropyl)piperazin-1-yl]methanone (PubChem CID 25261186) has the molecular formula C36H42Cl2F3N5O2 and a molecular weight of 704.67 g/mol. Its IUPAC name is [(4S,5R)-2-(6-tert-butyl-4-ethoxy-3-pyridinyl)-4,5-bis(4-chlorophenyl)-4,5-dimethylimidazol-1-yl]-[4-(3,3,3-trifluoropropyl)piperazin-1-yl]methanone.
| Compound Name | [(4S,5R)-2-(6-tert-butyl-4-ethoxy-3-pyridinyl)-4,5-bis(4-chlorophenyl)-4,5-dimethylimidazol-1-yl]-[4-(3,3,3-trifluoropropyl)piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 25261186 |
| Molecular Formula | C36H42Cl2F3N5O2 |
| Molecular Weight | 704.67 g/mol |
| Exact Mass | 703.27 |
| IUPAC Name | [(4S,5R)-2-(6-tert-butyl-4-ethoxy-3-pyridinyl)-4,5-bis(4-chlorophenyl)-4,5-dimethylimidazol-1-yl]-[4-(3,3,3-trifluoropropyl)piperazin-1-yl]methanone |
| SMILES | CCOc1cc(C(C)(C)C)ncc1C1=N[C@@](C)(c2ccc(Cl)cc2)[C@@](C)(c2ccc(Cl)cc2)N1C(=O)N1CCN(CCC(F)(F)F)CC1 |
| InChI | InChI=1S/C36H42Cl2F3N5O2/c1-7-48-29-22-30(33(2,3)4)42-23-28(29)31-43-34(5,24-8-12-26(37)13-9-24)35(6,25-10-14-27(38)15-11-25)46(31)32(47)45-20-18-44(19-21-45)17-16-36(39,40)41/h8-15,22-23H,7,16-21H2,1-6H3/t34-,35+/m0/s1 |
| InChIKey | LBTQKPIWQJIHFV-OIDHKYIRSA-N |
| XLogP | 8.67 |
| TPSA | 61.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 704.67 |
| LogP ≤ 5 | 8.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |