C29H30Cl3N3O2 — CID 91551511
(4S,5S)-2-(6-tert-butyl-4-ethoxy-3-pyridinyl)-4,5-bis(4-chlorophenyl)-4,5-dimethylimidazole-1-carbonyl chloride (PubChem CID 91551511) has the molecular formula C29H30Cl3N3O2 and a molecular weight of 558.94 g/mol. Its IUPAC name is (4S,5S)-2-(6-tert-butyl-4-ethoxy-3-pyridinyl)-4,5-bis(4-chlorophenyl)-4,5-dimethylimidazole-1-carbonyl chloride.
| Compound Name | (4S,5S)-2-(6-tert-butyl-4-ethoxy-3-pyridinyl)-4,5-bis(4-chlorophenyl)-4,5-dimethylimidazole-1-carbonyl chloride |
|---|---|
| PubChem CID | 91551511 |
| Molecular Formula | C29H30Cl3N3O2 |
| Molecular Weight | 558.94 g/mol |
| Exact Mass | 557.14 |
| IUPAC Name | (4S,5S)-2-(6-tert-butyl-4-ethoxy-3-pyridinyl)-4,5-bis(4-chlorophenyl)-4,5-dimethylimidazole-1-carbonyl chloride |
| SMILES | CCOc1cc(C(C)(C)C)ncc1C1=N[C@@](C)(c2ccc(Cl)cc2)[C@](C)(c2ccc(Cl)cc2)N1C(=O)Cl |
| InChI | InChI=1S/C29H30Cl3N3O2/c1-7-37-23-16-24(27(2,3)4)33-17-22(23)25-34-28(5,18-8-12-20(30)13-9-18)29(6,35(25)26(32)36)19-10-14-21(31)15-11-19/h8-17H,7H2,1-6H3/t28-,29-/m0/s1 |
| InChIKey | LNBOYHPEUONXQA-VMPREFPWSA-N |
| XLogP | 8.34 |
| TPSA | 54.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.94 |
| LogP ≤ 5 | 8.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|