C31H36Cl2N4O3 — CID 89120635
dimethylamino (4S,5R)-2-(6-tert-butyl-4-ethoxy-3-pyridinyl)-4,5-bis(4-chlorophenyl)-4,5-dimethylimidazole-1-carboxylate (PubChem CID 89120635) has the molecular formula C31H36Cl2N4O3 and a molecular weight of 583.56 g/mol. Its IUPAC name is dimethylamino (4S,5R)-2-(6-tert-butyl-4-ethoxy-3-pyridinyl)-4,5-bis(4-chlorophenyl)-4,5-dimethylimidazole-1-carboxylate.
| Compound Name | dimethylamino (4S,5R)-2-(6-tert-butyl-4-ethoxy-3-pyridinyl)-4,5-bis(4-chlorophenyl)-4,5-dimethylimidazole-1-carboxylate |
|---|---|
| PubChem CID | 89120635 |
| Molecular Formula | C31H36Cl2N4O3 |
| Molecular Weight | 583.56 g/mol |
| Exact Mass | 582.22 |
| IUPAC Name | dimethylamino (4S,5R)-2-(6-tert-butyl-4-ethoxy-3-pyridinyl)-4,5-bis(4-chlorophenyl)-4,5-dimethylimidazole-1-carboxylate |
| SMILES | CCOc1cc(C(C)(C)C)ncc1C1=N[C@@](C)(c2ccc(Cl)cc2)[C@@](C)(c2ccc(Cl)cc2)N1C(=O)ON(C)C |
| InChI | InChI=1S/C31H36Cl2N4O3/c1-9-39-25-18-26(29(2,3)4)34-19-24(25)27-35-30(5,20-10-14-22(32)15-11-20)31(6,21-12-16-23(33)17-13-21)37(27)28(38)40-36(7)8/h10-19H,9H2,1-8H3/t30-,31+/m0/s1 |
| InChIKey | PWXPUKNIWONAMJ-IOWSJCHKSA-N |
| XLogP | 7.59 |
| TPSA | 67.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.56 |
| LogP ≤ 5 | 7.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|