C29H29Cl3N2O3 — CID 73408763
4,5-bis(4-chlorophenyl)-2-[2-ethoxy-4-(2-hydroxypropan-2-yl)phenyl]-4,5-dimethylimidazole-1-carbonyl chloride (PubChem CID 73408763) has the molecular formula C29H29Cl3N2O3 and a molecular weight of 559.92 g/mol. Its IUPAC name is 4,5-bis(4-chlorophenyl)-2-[2-ethoxy-4-(2-hydroxypropan-2-yl)phenyl]-4,5-dimethylimidazole-1-carbonyl chloride.
| Compound Name | 4,5-bis(4-chlorophenyl)-2-[2-ethoxy-4-(2-hydroxypropan-2-yl)phenyl]-4,5-dimethylimidazole-1-carbonyl chloride |
|---|---|
| PubChem CID | 73408763 |
| Molecular Formula | C29H29Cl3N2O3 |
| Molecular Weight | 559.92 g/mol |
| Exact Mass | 558.12 |
| IUPAC Name | 4,5-bis(4-chlorophenyl)-2-[2-ethoxy-4-(2-hydroxypropan-2-yl)phenyl]-4,5-dimethylimidazole-1-carbonyl chloride |
| SMILES | CCOc1cc(C(C)(C)O)ccc1C1=NC(C)(c2ccc(Cl)cc2)C(C)(c2ccc(Cl)cc2)N1C(=O)Cl |
| InChI | InChI=1S/C29H29Cl3N2O3/c1-6-37-24-17-20(27(2,3)36)11-16-23(24)25-33-28(4,18-7-12-21(30)13-8-18)29(5,34(25)26(32)35)19-9-14-22(31)15-10-19/h7-17,36H,6H2,1-5H3 |
| InChIKey | JVPORQFXMWIFHA-UHFFFAOYSA-N |
| XLogP | 7.87 |
| TPSA | 62.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.92 |
| LogP ≤ 5 | 7.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|