C30H30Cl3N3O4S — CID 58894304
(4S,5R)-4,5-bis(4-chlorophenyl)-2-(2-ethoxy-4-pyrrolidin-1-ylsulfonylphenyl)-4,5-dimethylimidazole-1-carbonyl chloride (PubChem CID 58894304) has the molecular formula C30H30Cl3N3O4S and a molecular weight of 635.01 g/mol. Its IUPAC name is (4S,5R)-4,5-bis(4-chlorophenyl)-2-(2-ethoxy-4-pyrrolidin-1-ylsulfonylphenyl)-4,5-dimethylimidazole-1-carbonyl chloride.
| Compound Name | (4S,5R)-4,5-bis(4-chlorophenyl)-2-(2-ethoxy-4-pyrrolidin-1-ylsulfonylphenyl)-4,5-dimethylimidazole-1-carbonyl chloride |
|---|---|
| PubChem CID | 58894304 |
| Molecular Formula | C30H30Cl3N3O4S |
| Molecular Weight | 635.01 g/mol |
| Exact Mass | 633.10 |
| IUPAC Name | (4S,5R)-4,5-bis(4-chlorophenyl)-2-(2-ethoxy-4-pyrrolidin-1-ylsulfonylphenyl)-4,5-dimethylimidazole-1-carbonyl chloride |
| SMILES | CCOc1cc(S(=O)(=O)N2CCCC2)ccc1C1=N[C@@](C)(c2ccc(Cl)cc2)[C@@](C)(c2ccc(Cl)cc2)N1C(=O)Cl |
| InChI | InChI=1S/C30H30Cl3N3O4S/c1-4-40-26-19-24(41(38,39)35-17-5-6-18-35)15-16-25(26)27-34-29(2,20-7-11-22(31)12-8-20)30(3,36(27)28(33)37)21-9-13-23(32)14-10-21/h7-16,19H,4-6,17-18H2,1-3H3/t29-,30+/m0/s1 |
| InChIKey | UBQNQELJFANHEV-XZWHSSHBSA-N |
| XLogP | 7.43 |
| TPSA | 79.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 635.01 |
| LogP ≤ 5 | 7.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|