C30H29Cl4N3O5S — CID 90171941
(4S,5R)-2-(4-chloro-2-ethoxy-5-morpholin-4-ylsulfonylphenyl)-4,5-bis(4-chlorophenyl)-4,5-dimethylimidazole-1-carbonyl chloride (PubChem CID 90171941) has the molecular formula C30H29Cl4N3O5S and a molecular weight of 685.46 g/mol. Its IUPAC name is (4S,5R)-2-(4-chloro-2-ethoxy-5-morpholin-4-ylsulfonylphenyl)-4,5-bis(4-chlorophenyl)-4,5-dimethylimidazole-1-carbonyl chloride.
| Compound Name | (4S,5R)-2-(4-chloro-2-ethoxy-5-morpholin-4-ylsulfonylphenyl)-4,5-bis(4-chlorophenyl)-4,5-dimethylimidazole-1-carbonyl chloride |
|---|---|
| PubChem CID | 90171941 |
| Molecular Formula | C30H29Cl4N3O5S |
| Molecular Weight | 685.46 g/mol |
| Exact Mass | 683.06 |
| IUPAC Name | (4S,5R)-2-(4-chloro-2-ethoxy-5-morpholin-4-ylsulfonylphenyl)-4,5-bis(4-chlorophenyl)-4,5-dimethylimidazole-1-carbonyl chloride |
| SMILES | CCOc1cc(Cl)c(S(=O)(=O)N2CCOCC2)cc1C1=N[C@@](C)(c2ccc(Cl)cc2)[C@@](C)(c2ccc(Cl)cc2)N1C(=O)Cl |
| InChI | InChI=1S/C30H29Cl4N3O5S/c1-4-42-25-18-24(33)26(43(39,40)36-13-15-41-16-14-36)17-23(25)27-35-29(2,19-5-9-21(31)10-6-19)30(3,37(27)28(34)38)20-7-11-22(32)12-8-20/h5-12,17-18H,4,13-16H2,1-3H3/t29-,30+/m0/s1 |
| InChIKey | NZFQJFPZHDIWFY-XZWHSSHBSA-N |
| XLogP | 7.32 |
| TPSA | 88.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 685.46 |
| LogP ≤ 5 | 7.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|