C30H31Cl4N3O4S — CID 124647343
(4R,5S)-2-[5-(tert-butylsulfamoyl)-4-chloro-2-ethoxyphenyl]-4,5-bis(4-chlorophenyl)-4,5-dimethylimidazole-1-carbonyl chloride (PubChem CID 124647343) has the molecular formula C30H31Cl4N3O4S and a molecular weight of 671.47 g/mol. Its IUPAC name is (4R,5S)-2-[5-(tert-butylsulfamoyl)-4-chloro-2-ethoxyphenyl]-4,5-bis(4-chlorophenyl)-4,5-dimethylimidazole-1-carbonyl chloride.
| Compound Name | (4R,5S)-2-[5-(tert-butylsulfamoyl)-4-chloro-2-ethoxyphenyl]-4,5-bis(4-chlorophenyl)-4,5-dimethylimidazole-1-carbonyl chloride |
|---|---|
| PubChem CID | 124647343 |
| Molecular Formula | C30H31Cl4N3O4S |
| Molecular Weight | 671.47 g/mol |
| Exact Mass | 669.08 |
| IUPAC Name | (4R,5S)-2-[5-(tert-butylsulfamoyl)-4-chloro-2-ethoxyphenyl]-4,5-bis(4-chlorophenyl)-4,5-dimethylimidazole-1-carbonyl chloride |
| SMILES | CCOc1cc(Cl)c(S(=O)(=O)NC(C)(C)C)cc1C1=N[C@](C)(c2ccc(Cl)cc2)[C@](C)(c2ccc(Cl)cc2)N1C(=O)Cl |
| InChI | InChI=1S/C30H31Cl4N3O4S/c1-7-41-24-17-23(33)25(42(39,40)36-28(2,3)4)16-22(24)26-35-29(5,18-8-12-20(31)13-9-18)30(6,37(26)27(34)38)19-10-14-21(32)15-11-19/h8-17,36H,7H2,1-6H3/t29-,30+/m1/s1 |
| InChIKey | HCBIQBIMONINKR-IHLOFXLRSA-N |
| XLogP | 8.37 |
| TPSA | 88.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 671.47 |
| LogP ≤ 5 | 8.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|