C31H33Cl4N3O4S — CID 86720043
2-[5-(tert-butylsulfamoyl)-4-chloro-2-propan-2-yloxyphenyl]-4,5-bis(4-chlorophenyl)-4,5-dimethylimidazole-1-carbonyl chloride (PubChem CID 86720043) has the molecular formula C31H33Cl4N3O4S and a molecular weight of 685.50 g/mol. Its IUPAC name is 2-[5-(tert-butylsulfamoyl)-4-chloro-2-propan-2-yloxyphenyl]-4,5-bis(4-chlorophenyl)-4,5-dimethylimidazole-1-carbonyl chloride.
| Compound Name | 2-[5-(tert-butylsulfamoyl)-4-chloro-2-propan-2-yloxyphenyl]-4,5-bis(4-chlorophenyl)-4,5-dimethylimidazole-1-carbonyl chloride |
|---|---|
| PubChem CID | 86720043 |
| Molecular Formula | C31H33Cl4N3O4S |
| Molecular Weight | 685.50 g/mol |
| Exact Mass | 683.09 |
| IUPAC Name | 2-[5-(tert-butylsulfamoyl)-4-chloro-2-propan-2-yloxyphenyl]-4,5-bis(4-chlorophenyl)-4,5-dimethylimidazole-1-carbonyl chloride |
| SMILES | CC(C)Oc1cc(Cl)c(S(=O)(=O)NC(C)(C)C)cc1C1=NC(C)(c2ccc(Cl)cc2)C(C)(c2ccc(Cl)cc2)N1C(=O)Cl |
| InChI | InChI=1S/C31H33Cl4N3O4S/c1-18(2)42-25-17-24(34)26(43(40,41)37-29(3,4)5)16-23(25)27-36-30(6,19-8-12-21(32)13-9-19)31(7,38(27)28(35)39)20-10-14-22(33)15-11-20/h8-18,37H,1-7H3 |
| InChIKey | CJHXYVHOYLJQRC-UHFFFAOYSA-N |
| XLogP | 8.76 |
| TPSA | 88.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 685.50 |
| LogP ≤ 5 | 8.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|