C38H44Cl2N4O2 — CID 68682819
[(4S,5R)-2-(4-tert-butyl-2-propan-2-yloxyphenyl)-4,5-bis(4-chlorophenyl)-4,5-dimethylimidazol-1-yl]-(3,4,6,7-tetrahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl)methanone (PubChem CID 68682819) has the molecular formula C38H44Cl2N4O2 and a molecular weight of 659.70 g/mol. Its IUPAC name is [(4S,5R)-2-(4-tert-butyl-2-propan-2-yloxyphenyl)-4,5-bis(4-chlorophenyl)-4,5-dimethylimidazol-1-yl]-(3,4,6,7-tetrahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl)methanone.
| Compound Name | [(4S,5R)-2-(4-tert-butyl-2-propan-2-yloxyphenyl)-4,5-bis(4-chlorophenyl)-4,5-dimethylimidazol-1-yl]-(3,4,6,7-tetrahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl)methanone |
|---|---|
| PubChem CID | 68682819 |
| Molecular Formula | C38H44Cl2N4O2 |
| Molecular Weight | 659.70 g/mol |
| Exact Mass | 658.28 |
| IUPAC Name | [(4S,5R)-2-(4-tert-butyl-2-propan-2-yloxyphenyl)-4,5-bis(4-chlorophenyl)-4,5-dimethylimidazol-1-yl]-(3,4,6,7-tetrahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl)methanone |
| SMILES | CC(C)Oc1cc(C(C)(C)C)ccc1C1=N[C@@](C)(c2ccc(Cl)cc2)[C@@](C)(c2ccc(Cl)cc2)N1C(=O)N1CCN2CCC=C2C1 |
| InChI | InChI=1S/C38H44Cl2N4O2/c1-25(2)46-33-23-28(36(3,4)5)14-19-32(33)34-41-37(6,26-10-15-29(39)16-11-26)38(7,27-12-17-30(40)18-13-27)44(34)35(45)43-22-21-42-20-8-9-31(42)24-43/h9-19,23,25H,8,20-22,24H2,1-7H3/t37-,38+/m0/s1 |
| InChIKey | CPDTYGHLUODAMD-QPPIDDCLSA-N |
| XLogP | 9.00 |
| TPSA | 48.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 659.70 |
| LogP ≤ 5 | 9.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |