C24H21Cl3N4O3 — CID 131730819
4,5-bis(4-chlorophenyl)-2-(3,6-dimethoxypyridazin-4-yl)-4,5-dimethylimidazole-1-carbonyl chloride (PubChem CID 131730819) has the molecular formula C24H21Cl3N4O3 and a molecular weight of 519.82 g/mol. Its IUPAC name is 4,5-bis(4-chlorophenyl)-2-(3,6-dimethoxypyridazin-4-yl)-4,5-dimethylimidazole-1-carbonyl chloride.
| Compound Name | 4,5-bis(4-chlorophenyl)-2-(3,6-dimethoxypyridazin-4-yl)-4,5-dimethylimidazole-1-carbonyl chloride |
|---|---|
| PubChem CID | 131730819 |
| Molecular Formula | C24H21Cl3N4O3 |
| Molecular Weight | 519.82 g/mol |
| Exact Mass | 518.07 |
| IUPAC Name | 4,5-bis(4-chlorophenyl)-2-(3,6-dimethoxypyridazin-4-yl)-4,5-dimethylimidazole-1-carbonyl chloride |
| SMILES | COc1cc(C2=NC(C)(c3ccc(Cl)cc3)C(C)(c3ccc(Cl)cc3)N2C(=O)Cl)c(OC)nn1 |
| InChI | InChI=1S/C24H21Cl3N4O3/c1-23(14-5-9-16(25)10-6-14)24(2,15-7-11-17(26)12-8-15)31(22(27)32)20(28-23)18-13-19(33-3)29-30-21(18)34-4/h5-13H,1-4H3 |
| InChIKey | GGFITYGVKKOELV-UHFFFAOYSA-N |
| XLogP | 6.05 |
| TPSA | 76.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.82 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|