C32H36Cl3N3O4S — CID 91110464
(4S,5S)-2-[4-tert-butyl-5-(dimethylsulfamoyl)-2-ethoxyphenyl]-4,5-bis(4-chlorophenyl)-4,5-dimethylimidazole-1-carbonyl chloride (PubChem CID 91110464) has the molecular formula C32H36Cl3N3O4S and a molecular weight of 665.08 g/mol. Its IUPAC name is (4S,5S)-2-[4-tert-butyl-5-(dimethylsulfamoyl)-2-ethoxyphenyl]-4,5-bis(4-chlorophenyl)-4,5-dimethylimidazole-1-carbonyl chloride.
| Compound Name | (4S,5S)-2-[4-tert-butyl-5-(dimethylsulfamoyl)-2-ethoxyphenyl]-4,5-bis(4-chlorophenyl)-4,5-dimethylimidazole-1-carbonyl chloride |
|---|---|
| PubChem CID | 91110464 |
| Molecular Formula | C32H36Cl3N3O4S |
| Molecular Weight | 665.08 g/mol |
| Exact Mass | 663.15 |
| IUPAC Name | (4S,5S)-2-[4-tert-butyl-5-(dimethylsulfamoyl)-2-ethoxyphenyl]-4,5-bis(4-chlorophenyl)-4,5-dimethylimidazole-1-carbonyl chloride |
| SMILES | CCOc1cc(C(C)(C)C)c(S(=O)(=O)N(C)C)cc1C1=N[C@@](C)(c2ccc(Cl)cc2)[C@](C)(c2ccc(Cl)cc2)N1C(=O)Cl |
| InChI | InChI=1S/C32H36Cl3N3O4S/c1-9-42-26-19-25(30(2,3)4)27(43(40,41)37(7)8)18-24(26)28-36-31(5,20-10-14-22(33)15-11-20)32(6,38(28)29(35)39)21-12-16-23(34)17-13-21/h10-19H,9H2,1-8H3/t31-,32-/m0/s1 |
| InChIKey | NSUAPQOIKZATBG-ACHIHNKUSA-N |
| XLogP | 8.19 |
| TPSA | 79.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 665.08 |
| LogP ≤ 5 | 8.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|