C26H24N2O2 — CID 25261797
2-phenyl-N-[(1S)-1-phenylpropyl]-3-(tritritiomethoxy)quinoline-4-carboxamide (PubChem CID 25261797) has the molecular formula C26H24N2O2 and a molecular weight of 402.51 g/mol. Its IUPAC name is 2-phenyl-N-[(1S)-1-phenylpropyl]-3-(tritritiomethoxy)quinoline-4-carboxamide.
| Compound Name | 2-phenyl-N-[(1S)-1-phenylpropyl]-3-(tritritiomethoxy)quinoline-4-carboxamide |
|---|---|
| PubChem CID | 25261797 |
| Molecular Formula | C26H24N2O2 |
| Molecular Weight | 402.51 g/mol |
| Exact Mass | 402.21 |
| IUPAC Name | 2-phenyl-N-[(1S)-1-phenylpropyl]-3-(tritritiomethoxy)quinoline-4-carboxamide |
| SMILES | [3H]C([3H])([3H])Oc1c(-c2ccccc2)nc2ccccc2c1C(=O)N[C@@H](CC)c1ccccc1 |
| InChI | InChI=1S/C26H24N2O2/c1-3-21(18-12-6-4-7-13-18)28-26(29)23-20-16-10-11-17-22(20)27-24(25(23)30-2)19-14-8-5-9-15-19/h4-17,21H,3H2,1-2H3,(H,28,29)/t21-/m0/s1/i2T3 |
| InChIKey | DDBBEPOXFYJCCQ-XJPFECEASA-N |
| XLogP | 5.79 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.51 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |