C35H34N4O3 — CID 54177053
3-[2-[(2-amino-2-phenylacetyl)amino]ethoxy]-2-phenyl-N-[(1S)-1-phenylpropyl]quinoline-4-carboxamide (PubChem CID 54177053) has the molecular formula C35H34N4O3 and a molecular weight of 558.68 g/mol. Its IUPAC name is 3-[2-[(2-amino-2-phenylacetyl)amino]ethoxy]-2-phenyl-N-[(1S)-1-phenylpropyl]quinoline-4-carboxamide.
| Compound Name | 3-[2-[(2-amino-2-phenylacetyl)amino]ethoxy]-2-phenyl-N-[(1S)-1-phenylpropyl]quinoline-4-carboxamide |
|---|---|
| PubChem CID | 54177053 |
| Molecular Formula | C35H34N4O3 |
| Molecular Weight | 558.68 g/mol |
| Exact Mass | 558.26 |
| IUPAC Name | 3-[2-[(2-amino-2-phenylacetyl)amino]ethoxy]-2-phenyl-N-[(1S)-1-phenylpropyl]quinoline-4-carboxamide |
| SMILES | CC[C@H](NC(=O)c1c(OCCNC(=O)C(N)c2ccccc2)c(-c2ccccc2)nc2ccccc12)c1ccccc1 |
| InChI | InChI=1S/C35H34N4O3/c1-2-28(24-14-6-3-7-15-24)39-34(40)30-27-20-12-13-21-29(27)38-32(26-18-10-5-11-19-26)33(30)42-23-22-37-35(41)31(36)25-16-8-4-9-17-25/h3-21,28,31H,2,22-23,36H2,1H3,(H,37,41)(H,39,40)/t28-,31?/m0/s1 |
| InChIKey | OZCZKNAJVBODTD-NPHAVVRNSA-N |
| XLogP | 5.98 |
| TPSA | 106.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.68 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|