C24H22N4O2 — CID 140531563
3-amino-N-[1-(3-hydroxy-2-pyridinyl)propyl]-2-phenylquinoline-4-carboxamide (PubChem CID 140531563) has the molecular formula C24H22N4O2 and a molecular weight of 398.47 g/mol. Its IUPAC name is 3-amino-N-[1-(3-hydroxy-2-pyridinyl)propyl]-2-phenylquinoline-4-carboxamide.
| Compound Name | 3-amino-N-[1-(3-hydroxy-2-pyridinyl)propyl]-2-phenylquinoline-4-carboxamide |
|---|---|
| PubChem CID | 140531563 |
| Molecular Formula | C24H22N4O2 |
| Molecular Weight | 398.47 g/mol |
| Exact Mass | 398.17 |
| IUPAC Name | 3-amino-N-[1-(3-hydroxy-2-pyridinyl)propyl]-2-phenylquinoline-4-carboxamide |
| SMILES | CCC(NC(=O)c1c(N)c(-c2ccccc2)nc2ccccc12)c1ncccc1O |
| InChI | InChI=1S/C24H22N4O2/c1-2-17(23-19(29)13-8-14-26-23)28-24(30)20-16-11-6-7-12-18(16)27-22(21(20)25)15-9-4-3-5-10-15/h3-14,17,29H,2,25H2,1H3,(H,28,30) |
| InChIKey | HMQGDRKLYNPCDG-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 101.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.47 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |