C21H16FNS — CID 25262144
(E)-3-(3-fluorophenyl)sulfanyl-N,1-diphenylprop-2-en-1-imine (PubChem CID 25262144) has the molecular formula C21H16FNS and a molecular weight of 333.43 g/mol. Its IUPAC name is (E)-3-(3-fluorophenyl)sulfanyl-N,1-diphenylprop-2-en-1-imine.
| Compound Name | (E)-3-(3-fluorophenyl)sulfanyl-N,1-diphenylprop-2-en-1-imine |
|---|---|
| PubChem CID | 25262144 |
| Molecular Formula | C21H16FNS |
| Molecular Weight | 333.43 g/mol |
| Exact Mass | 333.10 |
| IUPAC Name | (E)-3-(3-fluorophenyl)sulfanyl-N,1-diphenylprop-2-en-1-imine |
| SMILES | Fc1cccc(S/C=C/C(=N/c2ccccc2)c2ccccc2)c1 |
| InChI | InChI=1S/C21H16FNS/c22-18-10-7-13-20(16-18)24-15-14-21(17-8-3-1-4-9-17)23-19-11-5-2-6-12-19/h1-16H/b15-14+,23-21- |
| InChIKey | KRZYBFUETJMCDO-GONAIXDFSA-N |
| XLogP | 6.25 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.43 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|