C21H14Cl3NS — CID 25261997
(E)-1-(4-chlorophenyl)-3-(2,4-dichlorophenyl)sulfanyl-N-phenylprop-2-en-1-imine (PubChem CID 25261997) has the molecular formula C21H14Cl3NS and a molecular weight of 418.78 g/mol. Its IUPAC name is (E)-1-(4-chlorophenyl)-3-(2,4-dichlorophenyl)sulfanyl-N-phenylprop-2-en-1-imine.
| Compound Name | (E)-1-(4-chlorophenyl)-3-(2,4-dichlorophenyl)sulfanyl-N-phenylprop-2-en-1-imine |
|---|---|
| PubChem CID | 25261997 |
| Molecular Formula | C21H14Cl3NS |
| Molecular Weight | 418.78 g/mol |
| Exact Mass | 416.99 |
| IUPAC Name | (E)-1-(4-chlorophenyl)-3-(2,4-dichlorophenyl)sulfanyl-N-phenylprop-2-en-1-imine |
| SMILES | Clc1ccc(C(/C=C/Sc2ccc(Cl)cc2Cl)=N\c2ccccc2)cc1 |
| InChI | InChI=1S/C21H14Cl3NS/c22-16-8-6-15(7-9-16)20(25-18-4-2-1-3-5-18)12-13-26-21-11-10-17(23)14-19(21)24/h1-14H/b13-12+,25-20- |
| InChIKey | OJJZDJYCYOSPAH-HGKHCVDQSA-N |
| XLogP | 8.07 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.78 |
| LogP ≤ 5 | 8.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|