C23H20ClNS — CID 25261995
(E)-1-(4-chlorophenyl)-3-(2,4-dimethylphenyl)sulfanyl-N-phenylprop-2-en-1-imine (PubChem CID 25261995) has the molecular formula C23H20ClNS and a molecular weight of 377.94 g/mol. Its IUPAC name is (E)-1-(4-chlorophenyl)-3-(2,4-dimethylphenyl)sulfanyl-N-phenylprop-2-en-1-imine.
| Compound Name | (E)-1-(4-chlorophenyl)-3-(2,4-dimethylphenyl)sulfanyl-N-phenylprop-2-en-1-imine |
|---|---|
| PubChem CID | 25261995 |
| Molecular Formula | C23H20ClNS |
| Molecular Weight | 377.94 g/mol |
| Exact Mass | 377.10 |
| IUPAC Name | (E)-1-(4-chlorophenyl)-3-(2,4-dimethylphenyl)sulfanyl-N-phenylprop-2-en-1-imine |
| SMILES | Cc1ccc(S/C=C/C(=N/c2ccccc2)c2ccc(Cl)cc2)c(C)c1 |
| InChI | InChI=1S/C23H20ClNS/c1-17-8-13-23(18(2)16-17)26-15-14-22(19-9-11-20(24)12-10-19)25-21-6-4-3-5-7-21/h3-16H,1-2H3/b15-14+,25-22- |
| InChIKey | BPGNOSMMCSCEHE-ZYAJNOEKSA-N |
| XLogP | 7.38 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.94 |
| LogP ≤ 5 | 7.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|